How is oleic acid oxidized?
How is oleic acid oxidized?
Oleic acid stimulates complete oxidation of fatty acids through protein kinase A-dependent activation of SIRT1-PGC1α complex.
How do you write oleic acid?
Oleic acid (cis-9-octadecenoic acid) is an omega-nine fatty acid and has the formula C18H34O2 (CH3(CH2)7CHCH(CH2)7COOH) (Figure 153.3). It is the most widely distributed of all the natural fatty acids and present in practically all lipids.
What is the molar mass of oleic acid?
282.47 g/molOleic acid / Molar mass
What is a triglyceride structure?
Triglycerides are lipid compounds composed of a glycerol esterified to 3 fatty acid chains of varying length and composition. These fatty acid chains can be saturated or unsaturated, and the chemical composition of each chain is different.
What is the equation for a reaction between iodine and oleic acid?
Iodine Value (IV) IV oleic acid = (2 × 127/282) × 100 = 90.1. IV glyceryl = [6 × 127/(41 + 3 × 281)] × 100 = 86.2 triolein similarly.
What is the molar mass of linoleic acid?
280.4472 g/molLinoleic acid / Molar mass
What is the name of C18H34O2?
Oleic acid
Oleic acid | C18H34O2 – PubChem.
What is the IUPAC name of oleic acid?
| IUPAC Name | (Z)-octadec-9-enoic acid |
|---|---|
| Molecular Formula | C18H34O2 |
| Molar Mass | 282.468 g/mol |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
| InChI Key | ZQPPMHVWECSIRJ-KTKRTIGZSA-N |
How does oleic acid stimulate complete oxidation of fatty acids?
Oleic acid stimulates complete oxidation of fatty acids through protein kinase A-dependent activation of SIRT1-PGC1α complex Fatty acids are essential components of the dynamic lipid metabolism in cells. Fatty acids can also signal to intracellular pathways to trigger a broad range of cellular responses.
What is the molecular formula for oleic acid?
Oleic acid PubChem CID 445639 Structure Find Similar Structures Chemical Safety Laboratory Chemical Safety Summary (LCSS Molecular Formula C18H34O2 or C8H17CH=CH(CH2)7COOH Synonyms oleic acid 112-80-1 cis-9-Octadecenoic a
Is oleic acid a monounsaturated fatty acid?
Oleic acid is an abundant monounsaturated omega-9 fatty acid that impinges on different biological processes, but the m … Oleic acid stimulates complete oxidation of fatty acids through protein kinase A-dependent activation of SIRT1-PGC1α complex J Biol Chem. 2013 Mar 8;288(10):7117-26.doi: 10.1074/jbc.M112.415729. Epub 2013 Jan 17.
How do you convert oleic acid to 10-hydroxyoctadecanoic acid?
Resting cells of Saccharomyces cerevisiae (baker’s yeast, type II; Sigma) were used to convert oleic acid into 10-hydroxyoctadecanoic acid with a 45% yield.